C49H96N4O6 — CID 149325376
undecan-3-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-[3-[[(E)-1-(methylamino)-2-nitroethenyl]amino]propyl]amino]octanoate (PubChem CID 149325376) has the molecular formula C49H96N4O6 and a molecular weight of 837.33 g/mol. Its IUPAC name is undecan-3-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-[3-[[(E)-1-(methylamino)-2-nitroethenyl]amino]propyl]amino]octanoate.
| Compound Name | undecan-3-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-[3-[[(E)-1-(methylamino)-2-nitroethenyl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 149325376 |
| Molecular Formula | C49H96N4O6 |
| Molecular Weight | 837.33 g/mol |
| Exact Mass | 836.73 |
| IUPAC Name | undecan-3-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-[3-[[(E)-1-(methylamino)-2-nitroethenyl]amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCC)CCCCCCCC)CCCN/C(=C/[N+](=O)[O-])NC |
| InChI | InChI=1S/C49H96N4O6/c1-6-10-13-16-21-27-35-45(9-4)58-48(54)38-30-23-18-25-32-41-52(43-34-40-51-47(50-5)44-53(56)57)42-33-26-19-24-31-39-49(55)59-46(36-28-20-15-12-8-3)37-29-22-17-14-11-7-2/h44-46,50-51H,6-43H2,1-5H3/b47-44+ |
| InChIKey | YBGJVIHXYJPFEE-VIFYOBDDSA-N |
| XLogP | 13.34 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.33 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|