C48H94N4O6 — CID 150629095
7-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[1-(methylamino)-2-nitroethenyl]amino]propyl]amino]heptyl decanoate (PubChem CID 150629095) has the molecular formula C48H94N4O6 and a molecular weight of 823.30 g/mol. Its IUPAC name is 7-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[1-(methylamino)-2-nitroethenyl]amino]propyl]amino]heptyl decanoate.
| Compound Name | 7-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[1-(methylamino)-2-nitroethenyl]amino]propyl]amino]heptyl decanoate |
|---|---|
| PubChem CID | 150629095 |
| Molecular Formula | C48H94N4O6 |
| Molecular Weight | 823.30 g/mol |
| Exact Mass | 822.72 |
| IUPAC Name | 7-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[1-(methylamino)-2-nitroethenyl]amino]propyl]amino]heptyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNC(=C[N+](=O)[O-])NC |
| InChI | InChI=1S/C48H94N4O6/c1-5-8-11-14-17-22-29-37-47(53)57-43-33-26-19-25-32-41-51(42-34-39-50-46(49-4)44-52(55)56)40-31-24-18-23-30-38-48(54)58-45(35-27-20-15-12-9-6-2)36-28-21-16-13-10-7-3/h44-45,49-50H,5-43H2,1-4H3 |
| InChIKey | IXMRVAMXJPCJMJ-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.30 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|