C40H78IN3O5 — CID 155720176
octyl 8-[[8-(1-iodoundecan-6-yloxy)-8-oxooctyl]-[3-(methylcarbamoylamino)propyl]amino]octanoate (PubChem CID 155720176) has the molecular formula C40H78IN3O5 and a molecular weight of 807.98 g/mol. Its IUPAC name is octyl 8-[[8-(1-iodoundecan-6-yloxy)-8-oxooctyl]-[3-(methylcarbamoylamino)propyl]amino]octanoate.
| Compound Name | octyl 8-[[8-(1-iodoundecan-6-yloxy)-8-oxooctyl]-[3-(methylcarbamoylamino)propyl]amino]octanoate |
|---|---|
| PubChem CID | 155720176 |
| Molecular Formula | C40H78IN3O5 |
| Molecular Weight | 807.98 g/mol |
| Exact Mass | 807.50 |
| IUPAC Name | octyl 8-[[8-(1-iodoundecan-6-yloxy)-8-oxooctyl]-[3-(methylcarbamoylamino)propyl]amino]octanoate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCC)CCCCCI)CCCNC(=O)NC |
| InChI | InChI=1S/C40H78IN3O5/c1-4-6-8-9-16-25-36-48-38(45)29-20-12-10-14-23-33-44(35-26-32-43-40(47)42-3)34-24-15-11-13-21-30-39(46)49-37(27-18-7-5-2)28-19-17-22-31-41/h37H,4-36H2,1-3H3,(H2,42,43,47) |
| InChIKey | QIPNRISZMAKYTN-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.98 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|