C47H95N3O5 — CID 139376650
nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-[3-(methylcarbamoylamino)propyl]amino]octanoate (PubChem CID 139376650) has the molecular formula C47H95N3O5 and a molecular weight of 782.29 g/mol. Its IUPAC name is nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-[3-(methylcarbamoylamino)propyl]amino]octanoate.
| Compound Name | nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-[3-(methylcarbamoylamino)propyl]amino]octanoate |
|---|---|
| PubChem CID | 139376650 |
| Molecular Formula | C47H95N3O5 |
| Molecular Weight | 782.29 g/mol |
| Exact Mass | 781.73 |
| IUPAC Name | nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-[3-(methylcarbamoylamino)propyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(O)OC(CCCCCCCC)CCCCCCCC)CCCNC(=O)NC |
| InChI | InChI=1S/C47H95N3O5/c1-5-8-11-14-17-26-33-43-54-45(51)37-29-22-18-24-31-40-50(42-34-39-49-47(53)48-4)41-32-25-19-23-30-38-46(52)55-44(35-27-20-15-12-9-6-2)36-28-21-16-13-10-7-3/h44,46,52H,5-43H2,1-4H3,(H2,48,49,53) |
| InChIKey | KOQLPXSRMCPXEO-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.29 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|