C48H98N4O6S — CID 167036830
nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-[5-methylimino-5-(sulfamoylamino)pentyl]amino]octanoate (PubChem CID 167036830) has the molecular formula C48H98N4O6S and a molecular weight of 859.40 g/mol. Its IUPAC name is nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-[5-methylimino-5-(sulfamoylamino)pentyl]amino]octanoate.
| Compound Name | nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-[5-methylimino-5-(sulfamoylamino)pentyl]amino]octanoate |
|---|---|
| PubChem CID | 167036830 |
| Molecular Formula | C48H98N4O6S |
| Molecular Weight | 859.40 g/mol |
| Exact Mass | 858.72 |
| IUPAC Name | nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-[5-methylimino-5-(sulfamoylamino)pentyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(O)OC(CCCCCCCC)CCCCCCCC)CCCC/C(=N\C)NS(N)(=O)=O |
| InChI | InChI=1S/C48H98N4O6S/c1-5-8-11-14-17-26-35-44-57-47(53)39-29-22-18-24-32-41-52(43-34-31-38-46(50-4)51-59(49,55)56)42-33-25-19-23-30-40-48(54)58-45(36-27-20-15-12-9-6-2)37-28-21-16-13-10-7-3/h45,48,54H,5-44H2,1-4H3,(H,50,51)(H2,49,55,56) |
| InChIKey | ZYOCBKABNGNPRJ-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.40 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|