C40H81NO5 — CID 138492393
nonyl 4-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-(2-hydroxyethyl)amino]butanoate (PubChem CID 138492393) has the molecular formula C40H81NO5 and a molecular weight of 656.09 g/mol. Its IUPAC name is nonyl 4-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-(2-hydroxyethyl)amino]butanoate.
| Compound Name | nonyl 4-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-(2-hydroxyethyl)amino]butanoate |
|---|---|
| PubChem CID | 138492393 |
| Molecular Formula | C40H81NO5 |
| Molecular Weight | 656.09 g/mol |
| Exact Mass | 655.61 |
| IUPAC Name | nonyl 4-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-(2-hydroxyethyl)amino]butanoate |
| SMILES | CCCCCCCCCOC(=O)CCCN(CCO)CCCCCCCC(O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C40H81NO5/c1-4-7-10-13-16-22-27-37-45-39(43)32-28-34-41(35-36-42)33-26-21-17-20-25-31-40(44)46-38(29-23-18-14-11-8-5-2)30-24-19-15-12-9-6-3/h38,40,42,44H,4-37H2,1-3H3 |
| InChIKey | NLUKDDGVXFCWQH-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.09 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|