C45H91NO5 — CID 134560984
nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-(3-hydroxypropyl)amino]octanoate (PubChem CID 134560984) has the molecular formula C45H91NO5 and a molecular weight of 726.22 g/mol. Its IUPAC name is nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-(3-hydroxypropyl)amino]octanoate.
| Compound Name | nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-(3-hydroxypropyl)amino]octanoate |
|---|---|
| PubChem CID | 134560984 |
| Molecular Formula | C45H91NO5 |
| Molecular Weight | 726.22 g/mol |
| Exact Mass | 725.69 |
| IUPAC Name | nonyl 8-[(8-heptadecan-9-yloxy-8-hydroxyoctyl)-(3-hydroxypropyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCO)CCCCCCCC(O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C45H91NO5/c1-4-7-10-13-16-25-32-42-50-44(48)36-28-21-17-23-30-38-46(40-33-41-47)39-31-24-18-22-29-37-45(49)51-43(34-26-19-14-11-8-5-2)35-27-20-15-12-9-6-3/h43,45,47,49H,4-42H2,1-3H3 |
| InChIKey | VACBPLNMQXFVCB-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.22 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|