C48H96FNO4 — CID 142497734
nonyl 8-[(4-fluoro-4-methylpentyl)-(8-heptadecan-9-yloxy-8-hydroxyoctyl)amino]octanoate (PubChem CID 142497734) has the molecular formula C48H96FNO4 and a molecular weight of 770.30 g/mol. Its IUPAC name is nonyl 8-[(4-fluoro-4-methylpentyl)-(8-heptadecan-9-yloxy-8-hydroxyoctyl)amino]octanoate.
| Compound Name | nonyl 8-[(4-fluoro-4-methylpentyl)-(8-heptadecan-9-yloxy-8-hydroxyoctyl)amino]octanoate |
|---|---|
| PubChem CID | 142497734 |
| Molecular Formula | C48H96FNO4 |
| Molecular Weight | 770.30 g/mol |
| Exact Mass | 769.73 |
| IUPAC Name | nonyl 8-[(4-fluoro-4-methylpentyl)-(8-heptadecan-9-yloxy-8-hydroxyoctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(O)OC(CCCCCCCC)CCCCCCCC)CCCC(C)(C)F |
| InChI | InChI=1S/C48H96FNO4/c1-6-9-12-15-18-27-34-44-53-46(51)38-30-23-19-25-32-41-50(43-35-40-48(4,5)49)42-33-26-20-24-31-39-47(52)54-45(36-28-21-16-13-10-7-2)37-29-22-17-14-11-8-3/h45,47,52H,6-44H2,1-5H3 |
| InChIKey | FAXPORYFPLYUDA-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.30 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|