C47H92F3NO3 — CID 142378847
nonyl 8-[8-heptadecan-9-yloxynonyl(4,4,4-trifluorobutyl)amino]octanoate (PubChem CID 142378847) has the molecular formula C47H92F3NO3 and a molecular weight of 776.25 g/mol. Its IUPAC name is nonyl 8-[8-heptadecan-9-yloxynonyl(4,4,4-trifluorobutyl)amino]octanoate.
| Compound Name | nonyl 8-[8-heptadecan-9-yloxynonyl(4,4,4-trifluorobutyl)amino]octanoate |
|---|---|
| PubChem CID | 142378847 |
| Molecular Formula | C47H92F3NO3 |
| Molecular Weight | 776.25 g/mol |
| Exact Mass | 775.70 |
| IUPAC Name | nonyl 8-[8-heptadecan-9-yloxynonyl(4,4,4-trifluorobutyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(C)OC(CCCCCCCC)CCCCCCCC)CCCC(F)(F)F |
| InChI | InChI=1S/C47H92F3NO3/c1-5-8-11-14-17-26-33-43-53-46(52)38-30-23-19-25-32-41-51(42-34-39-47(48,49)50)40-31-24-18-20-27-35-44(4)54-45(36-28-21-15-12-9-6-2)37-29-22-16-13-10-7-3/h44-45H,5-43H2,1-4H3 |
| InChIKey | UFGWXUHLSHNCIN-UHFFFAOYSA-N |
| XLogP | 15.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.25 |
| LogP ≤ 5 | 15.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|