C40H76N2O4 — CID 155720091
heptyl 8-[2-cyanoethyl-(8-hydroxy-8-tetradec-13-en-7-yloxyoctyl)amino]octanoate (PubChem CID 155720091) has the molecular formula C40H76N2O4 and a molecular weight of 649.06 g/mol. Its IUPAC name is heptyl 8-[2-cyanoethyl-(8-hydroxy-8-tetradec-13-en-7-yloxyoctyl)amino]octanoate.
| Compound Name | heptyl 8-[2-cyanoethyl-(8-hydroxy-8-tetradec-13-en-7-yloxyoctyl)amino]octanoate |
|---|---|
| PubChem CID | 155720091 |
| Molecular Formula | C40H76N2O4 |
| Molecular Weight | 649.06 g/mol |
| Exact Mass | 648.58 |
| IUPAC Name | heptyl 8-[2-cyanoethyl-(8-hydroxy-8-tetradec-13-en-7-yloxyoctyl)amino]octanoate |
| SMILES | C=CCCCCCC(CCCCCC)OC(O)CCCCCCCN(CCC#N)CCCCCCCC(=O)OCCCCCCC |
| InChI | InChI=1S/C40H76N2O4/c1-4-7-10-15-22-30-38(29-21-12-9-6-3)46-40(44)32-24-17-14-19-26-35-42(36-28-33-41)34-25-18-13-16-23-31-39(43)45-37-27-20-11-8-5-2/h4,38,40,44H,1,5-32,34-37H2,2-3H3 |
| InChIKey | SXSZJGSODQONHS-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.06 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|