C48H94N2O5 — CID 162259927
nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[5-(methylamino)-5-oxopentyl]amino]octanoate (PubChem CID 162259927) has the molecular formula C48H94N2O5 and a molecular weight of 779.29 g/mol. Its IUPAC name is nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[5-(methylamino)-5-oxopentyl]amino]octanoate.
| Compound Name | nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[5-(methylamino)-5-oxopentyl]amino]octanoate |
|---|---|
| PubChem CID | 162259927 |
| Molecular Formula | C48H94N2O5 |
| Molecular Weight | 779.29 g/mol |
| Exact Mass | 778.72 |
| IUPAC Name | nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[5-(methylamino)-5-oxopentyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCCC(=O)NC |
| InChI | InChI=1S/C48H94N2O5/c1-5-8-11-14-17-26-35-44-54-47(52)39-29-22-18-24-32-41-50(43-34-31-38-46(51)49-4)42-33-25-19-23-30-40-48(53)55-45(36-27-20-15-12-9-6-2)37-28-21-16-13-10-7-3/h45H,5-44H2,1-4H3,(H,49,51) |
| InChIKey | GYVWMHFOTRALED-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.29 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|