C49H98N2O5 — CID 155782396
nonyl 8-[8-(heptadecan-9-yloxymethoxy)octyl-[3-(propanoylamino)propyl]amino]octanoate (PubChem CID 155782396) has the molecular formula C49H98N2O5 and a molecular weight of 795.33 g/mol. Its IUPAC name is nonyl 8-[8-(heptadecan-9-yloxymethoxy)octyl-[3-(propanoylamino)propyl]amino]octanoate.
| Compound Name | nonyl 8-[8-(heptadecan-9-yloxymethoxy)octyl-[3-(propanoylamino)propyl]amino]octanoate |
|---|---|
| PubChem CID | 155782396 |
| Molecular Formula | C49H98N2O5 |
| Molecular Weight | 795.33 g/mol |
| Exact Mass | 794.75 |
| IUPAC Name | nonyl 8-[8-(heptadecan-9-yloxymethoxy)octyl-[3-(propanoylamino)propyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCCOCOC(CCCCCCCC)CCCCCCCC)CCCNC(=O)CC |
| InChI | InChI=1S/C49H98N2O5/c1-5-9-12-15-19-28-35-45-55-49(53)39-31-24-21-26-33-42-51(43-36-40-50-48(52)8-4)41-32-25-18-20-27-34-44-54-46-56-47(37-29-22-16-13-10-6-2)38-30-23-17-14-11-7-3/h47H,5-46H2,1-4H3,(H,50,52) |
| InChIKey | JLUVLSQQWGCYKT-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.33 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|