C45H92NO4+ — CID 170756727
8-(heptadecan-9-yloxymethoxy)octyl-dimethyl-(8-nonoxy-8-oxooctyl)azanium (PubChem CID 170756727) has the molecular formula C45H92NO4+ and a molecular weight of 711.23 g/mol. Its IUPAC name is 8-(heptadecan-9-yloxymethoxy)octyl-dimethyl-(8-nonoxy-8-oxooctyl)azanium.
| Compound Name | 8-(heptadecan-9-yloxymethoxy)octyl-dimethyl-(8-nonoxy-8-oxooctyl)azanium |
|---|---|
| PubChem CID | 170756727 |
| Molecular Formula | C45H92NO4+ |
| Molecular Weight | 711.23 g/mol |
| Exact Mass | 710.70 |
| IUPAC Name | 8-(heptadecan-9-yloxymethoxy)octyl-dimethyl-(8-nonoxy-8-oxooctyl)azanium |
| SMILES | CCCCCCCCCOC(=O)CCCCCCC[N+](C)(C)CCCCCCCCOCOC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C45H92NO4/c1-6-9-12-15-19-28-35-42-49-45(47)38-31-24-21-26-33-40-46(4,5)39-32-25-18-20-27-34-41-48-43-50-44(36-29-22-16-13-10-7-2)37-30-23-17-14-11-8-3/h44H,6-43H2,1-5H3/q+1 |
| InChIKey | AFWKFKIVYBBCAU-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.23 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|