C26H54Br2N2O4 — CID 10008992
hexyl-[2-[6-[2-[hexyl(dimethyl)azaniumyl]ethoxy]-6-oxohexanoyl]oxyethyl]-dimethylazanium dibromide (PubChem CID 10008992) has the molecular formula C26H54Br2N2O4 and a molecular weight of 618.54 g/mol. Its IUPAC name is hexyl-[2-[6-[2-[hexyl(dimethyl)azaniumyl]ethoxy]-6-oxohexanoyl]oxyethyl]-dimethylazanium dibromide.
| Compound Name | hexyl-[2-[6-[2-[hexyl(dimethyl)azaniumyl]ethoxy]-6-oxohexanoyl]oxyethyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 10008992 |
| Molecular Formula | C26H54Br2N2O4 |
| Molecular Weight | 618.54 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | hexyl-[2-[6-[2-[hexyl(dimethyl)azaniumyl]ethoxy]-6-oxohexanoyl]oxyethyl]-dimethylazanium dibromide |
| SMILES | CCCCCC[N+](C)(C)CCOC(=O)CCCCC(=O)OCC[N+](C)(C)CCCCCC.[Br-].[Br-] |
| InChI | InChI=1S/C26H54N2O4.2BrH/c1-7-9-11-15-19-27(3,4)21-23-31-25(29)17-13-14-18-26(30)32-24-22-28(5,6)20-16-12-10-8-2;;/h7-24H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | BHEIBLHBUJMPAP-UHFFFAOYSA-L |
| XLogP | -1.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.54 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|