C31H60NO6+ — CID 57212063
methyl-tris(2-octanoyloxyethyl)azanium (PubChem CID 57212063) has the molecular formula C31H60NO6+ and a molecular weight of 542.82 g/mol. Its IUPAC name is methyl-tris(2-octanoyloxyethyl)azanium.
| Compound Name | methyl-tris(2-octanoyloxyethyl)azanium |
|---|---|
| PubChem CID | 57212063 |
| Molecular Formula | C31H60NO6+ |
| Molecular Weight | 542.82 g/mol |
| Exact Mass | 542.44 |
| IUPAC Name | methyl-tris(2-octanoyloxyethyl)azanium |
| SMILES | CCCCCCCC(=O)OCC[N+](C)(CCOC(=O)CCCCCCC)CCOC(=O)CCCCCCC |
| InChI | InChI=1S/C31H60NO6/c1-5-8-11-14-17-20-29(33)36-26-23-32(4,24-27-37-30(34)21-18-15-12-9-6-2)25-28-38-31(35)22-19-16-13-10-7-3/h5-28H2,1-4H3/q+1 |
| InChIKey | MVVMFKOOLSBVBM-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.82 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|