C19H38NO5+ — CID 87165402
bis(2-hexanoyloxyethyl)-(2-hydroxyethyl)-methylazanium (PubChem CID 87165402) has the molecular formula C19H38NO5+ and a molecular weight of 360.52 g/mol. Its IUPAC name is bis(2-hexanoyloxyethyl)-(2-hydroxyethyl)-methylazanium.
| Compound Name | bis(2-hexanoyloxyethyl)-(2-hydroxyethyl)-methylazanium |
|---|---|
| PubChem CID | 87165402 |
| Molecular Formula | C19H38NO5+ |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | bis(2-hexanoyloxyethyl)-(2-hydroxyethyl)-methylazanium |
| SMILES | CCCCCC(=O)OCC[N+](C)(CCO)CCOC(=O)CCCCC |
| InChI | InChI=1S/C19H38NO5/c1-4-6-8-10-18(22)24-16-13-20(3,12-15-21)14-17-25-19(23)11-9-7-5-2/h21H,4-17H2,1-3H3/q+1 |
| InChIKey | HFKADZKCGQTIEF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|