C43H78NO5+ — CID 175883266
2-hydroxyethyl-methyl-bis[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium (PubChem CID 175883266) has the molecular formula C43H78NO5+ and a molecular weight of 689.10 g/mol. Its IUPAC name is 2-hydroxyethyl-methyl-bis[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium.
| Compound Name | 2-hydroxyethyl-methyl-bis[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 175883266 |
| Molecular Formula | C43H78NO5+ |
| Molecular Weight | 689.10 g/mol |
| Exact Mass | 688.59 |
| IUPAC Name | 2-hydroxyethyl-methyl-bis[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC[N+](C)(CCO)CCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H78NO5/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-42(46)48-40-37-44(3,36-39-45)38-41-49-43(47)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,45H,4-11,16-17,22-41H2,1-3H3/q+1/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | RKELCKNZTIXXJG-QYCRHRGJSA-N |
| XLogP | 11.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.10 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|