C61H108NO6+ — CID 134226715
methyl-tris[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium (PubChem CID 134226715) has the molecular formula C61H108NO6+ and a molecular weight of 951.54 g/mol. Its IUPAC name is methyl-tris[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium.
| Compound Name | methyl-tris[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 134226715 |
| Molecular Formula | C61H108NO6+ |
| Molecular Weight | 951.54 g/mol |
| Exact Mass | 950.82 |
| IUPAC Name | methyl-tris[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC[N+](C)(CCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)CCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C61H108NO6/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-47-50-59(63)66-56-53-62(4,54-57-67-60(64)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-2)55-58-68-61(65)52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-3/h17-22,26-31H,5-16,23-25,32-58H2,1-4H3/q+1/b20-17-,21-18-,22-19-,29-26-,30-27-,31-28- |
| InChIKey | HNMOAPYINKOXRO-IXQWNJBLSA-N |
| XLogP | 17.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.54 |
| LogP ≤ 5 | 17.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|