C22H38NO3+ — CID 151509953
benzyl-(2-decanoyloxyethyl)-(2-hydroxyethyl)-methylazanium (PubChem CID 151509953) has the molecular formula C22H38NO3+ and a molecular weight of 364.55 g/mol. Its IUPAC name is benzyl-(2-decanoyloxyethyl)-(2-hydroxyethyl)-methylazanium.
| Compound Name | benzyl-(2-decanoyloxyethyl)-(2-hydroxyethyl)-methylazanium |
|---|---|
| PubChem CID | 151509953 |
| Molecular Formula | C22H38NO3+ |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | benzyl-(2-decanoyloxyethyl)-(2-hydroxyethyl)-methylazanium |
| SMILES | CCCCCCCCCC(=O)OCC[N+](C)(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C22H38NO3/c1-3-4-5-6-7-8-12-15-22(25)26-19-17-23(2,16-18-24)20-21-13-10-9-11-14-21/h9-11,13-14,24H,3-8,12,15-20H2,1-2H3/q+1 |
| InChIKey | PSFXVSJODCQDCI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|