C50H102N2O6 — CID 155599590
molecular hydrogen;nonyl 8-[8-(heptadecan-9-yloxymethoxy)octyl-[3-(3-methoxypropanoylamino)propyl]amino]octanoate (PubChem CID 155599590) has the molecular formula C50H102N2O6 and a molecular weight of 827.37 g/mol. Its IUPAC name is molecular hydrogen;nonyl 8-[8-(heptadecan-9-yloxymethoxy)octyl-[3-(3-methoxypropanoylamino)propyl]amino]octanoate.
| Compound Name | molecular hydrogen;nonyl 8-[8-(heptadecan-9-yloxymethoxy)octyl-[3-(3-methoxypropanoylamino)propyl]amino]octanoate |
|---|---|
| PubChem CID | 155599590 |
| Molecular Formula | C50H102N2O6 |
| Molecular Weight | 827.37 g/mol |
| Exact Mass | 826.77 |
| IUPAC Name | molecular hydrogen;nonyl 8-[8-(heptadecan-9-yloxymethoxy)octyl-[3-(3-methoxypropanoylamino)propyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCCOCOC(CCCCCCCC)CCCCCCCC)CCCNC(=O)CCOC.[H][H] |
| InChI | InChI=1S/C50H100N2O6.H2/c1-5-8-11-14-18-27-34-45-57-50(54)38-30-23-20-25-32-42-52(43-35-40-51-49(53)39-46-55-4)41-31-24-17-19-26-33-44-56-47-58-48(36-28-21-15-12-9-6-2)37-29-22-16-13-10-7-3;/h48H,5-47H2,1-4H3,(H,51,53);1H |
| InChIKey | JHMUWDNIHKNIIN-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.37 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|