C45H92N2O6 — CID 178021790
molecular hydrogen;nonyl 8-[7,7-dioctoxyheptyl-[3-(methoxycarbonylamino)propyl]amino]octanoate (PubChem CID 178021790) has the molecular formula C45H92N2O6 and a molecular weight of 757.24 g/mol. Its IUPAC name is molecular hydrogen;nonyl 8-[7,7-dioctoxyheptyl-[3-(methoxycarbonylamino)propyl]amino]octanoate.
| Compound Name | molecular hydrogen;nonyl 8-[7,7-dioctoxyheptyl-[3-(methoxycarbonylamino)propyl]amino]octanoate |
|---|---|
| PubChem CID | 178021790 |
| Molecular Formula | C45H92N2O6 |
| Molecular Weight | 757.24 g/mol |
| Exact Mass | 756.70 |
| IUPAC Name | molecular hydrogen;nonyl 8-[7,7-dioctoxyheptyl-[3-(methoxycarbonylamino)propyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCC(OCCCCCCCC)OCCCCCCCC)CCCNC(=O)OC.[H][H] |
| InChI | InChI=1S/C45H90N2O6.H2/c1-5-8-11-14-17-25-30-40-51-43(48)34-26-19-18-21-28-37-47(39-33-36-46-45(49)50-4)38-29-22-20-27-35-44(52-41-31-23-15-12-9-6-2)53-42-32-24-16-13-10-7-3;/h44H,5-42H2,1-4H3,(H,46,49);1H |
| InChIKey | WNKBLHPWJZOHRY-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.24 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|