C89H176N2O12 — CID 163941873
nonyl 8-[2-acetyloxyethyl(7,7-dioctoxyheptyl)amino]octanoate;nonyl 8-[3-acetyloxypropyl(7,7-dioctoxyheptyl)amino]octanoate (PubChem CID 163941873) has the molecular formula C89H176N2O12 and a molecular weight of 1466.39 g/mol. Its IUPAC name is nonyl 8-[2-acetyloxyethyl(7,7-dioctoxyheptyl)amino]octanoate;nonyl 8-[3-acetyloxypropyl(7,7-dioctoxyheptyl)amino]octanoate.
| Compound Name | nonyl 8-[2-acetyloxyethyl(7,7-dioctoxyheptyl)amino]octanoate;nonyl 8-[3-acetyloxypropyl(7,7-dioctoxyheptyl)amino]octanoate |
|---|---|
| PubChem CID | 163941873 |
| Molecular Formula | C89H176N2O12 |
| Molecular Weight | 1466.39 g/mol |
| Exact Mass | 1465.32 |
| IUPAC Name | nonyl 8-[2-acetyloxyethyl(7,7-dioctoxyheptyl)amino]octanoate;nonyl 8-[3-acetyloxypropyl(7,7-dioctoxyheptyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCC(OCCCCCCCC)OCCCCCCCC)CCCOC(C)=O.CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCC(OCCCCCCCC)OCCCCCCCC)CCOC(C)=O |
| InChI | InChI=1S/C45H89NO6.C44H87NO6/c1-5-8-11-14-17-25-30-39-50-44(48)34-26-19-18-21-28-36-46(38-33-42-49-43(4)47)37-29-22-20-27-35-45(51-40-31-23-15-12-9-6-2)52-41-32-24-16-13-10-7-3;1-5-8-11-14-17-25-30-38-49-43(47)33-26-19-18-21-28-35-45(37-41-48-42(4)46)36-29-22-20-27-34-44(50-39-31-23-15-12-9-6-2)51-40-32-24-16-13-10-7-3/h45H,5-42H2,1-4H3;44H,5-41H2,1-4H3 |
| InChIKey | RRRTVBZCIPPRNA-UHFFFAOYSA-N |
| XLogP | 25.42 |
| TPSA | 148.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 85 |
| Heavy Atoms | 103 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1466.39 |
| LogP ≤ 5 | 25.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|