C53H110N4O5 — CID 155782461
azane;nonyl 8-[3-[[(Z)-2-amino-3-[(2-methylpropan-2-yl)oxy]prop-1-enyl]amino]propyl-[8-(heptadecan-9-yloxymethoxy)octyl]amino]octanoate (PubChem CID 155782461) has the molecular formula C53H110N4O5 and a molecular weight of 883.49 g/mol. Its IUPAC name is azane;nonyl 8-[3-[[(Z)-2-amino-3-[(2-methylpropan-2-yl)oxy]prop-1-enyl]amino]propyl-[8-(heptadecan-9-yloxymethoxy)octyl]amino]octanoate.
| Compound Name | azane;nonyl 8-[3-[[(Z)-2-amino-3-[(2-methylpropan-2-yl)oxy]prop-1-enyl]amino]propyl-[8-(heptadecan-9-yloxymethoxy)octyl]amino]octanoate |
|---|---|
| PubChem CID | 155782461 |
| Molecular Formula | C53H110N4O5 |
| Molecular Weight | 883.49 g/mol |
| Exact Mass | 882.85 |
| IUPAC Name | azane;nonyl 8-[3-[[(Z)-2-amino-3-[(2-methylpropan-2-yl)oxy]prop-1-enyl]amino]propyl-[8-(heptadecan-9-yloxymethoxy)octyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCCOCOC(CCCCCCCC)CCCCCCCC)CCCN/C=C(\N)COC(C)(C)C.N |
| InChI | InChI=1S/C53H107N3O5.H3N/c1-7-10-13-16-20-29-36-46-59-52(57)40-32-25-22-27-34-43-56(44-37-41-55-47-50(54)48-61-53(4,5)6)42-33-26-19-21-28-35-45-58-49-60-51(38-30-23-17-14-11-8-2)39-31-24-18-15-12-9-3;/h47,51,55H,7-46,48-49,54H2,1-6H3;1H3/b50-47-; |
| InChIKey | OOCKEPYAKQZZHX-JWUCRONHSA-N |
| XLogP | 14.88 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.49 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|