C48H94N4O6 — CID 139581692
2-[6-[3-[[1-(methylamino)-2-nitroethenyl]amino]propyl-(8-nonoxy-8-oxooctyl)amino]hexyl]-3-octylundecanoic acid (PubChem CID 139581692) has the molecular formula C48H94N4O6 and a molecular weight of 823.30 g/mol. Its IUPAC name is 2-[6-[3-[[1-(methylamino)-2-nitroethenyl]amino]propyl-(8-nonoxy-8-oxooctyl)amino]hexyl]-3-octylundecanoic acid.
| Compound Name | 2-[6-[3-[[1-(methylamino)-2-nitroethenyl]amino]propyl-(8-nonoxy-8-oxooctyl)amino]hexyl]-3-octylundecanoic acid |
|---|---|
| PubChem CID | 139581692 |
| Molecular Formula | C48H94N4O6 |
| Molecular Weight | 823.30 g/mol |
| Exact Mass | 822.72 |
| IUPAC Name | 2-[6-[3-[[1-(methylamino)-2-nitroethenyl]amino]propyl-(8-nonoxy-8-oxooctyl)amino]hexyl]-3-octylundecanoic acid |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCC(C(=O)O)C(CCCCCCCC)CCCCCCCC)CCCNC(=C[N+](=O)[O-])NC |
| InChI | InChI=1S/C48H94N4O6/c1-5-8-11-14-17-25-32-42-58-47(53)37-29-21-18-23-30-39-51(41-33-38-50-46(49-4)43-52(56)57)40-31-24-22-28-36-45(48(54)55)44(34-26-19-15-12-9-6-2)35-27-20-16-13-10-7-3/h43-45,49-50H,5-42H2,1-4H3,(H,54,55) |
| InChIKey | VVWUAILBAVCCLU-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.30 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|