C43H84N4O6 — CID 155278531
octyl 8-[3-[[(Z)-1-(dimethylamino)-2-nitroethenyl]amino]propyl-(8-dodecan-6-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 155278531) has the molecular formula C43H84N4O6 and a molecular weight of 753.17 g/mol. Its IUPAC name is octyl 8-[3-[[(Z)-1-(dimethylamino)-2-nitroethenyl]amino]propyl-(8-dodecan-6-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | octyl 8-[3-[[(Z)-1-(dimethylamino)-2-nitroethenyl]amino]propyl-(8-dodecan-6-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 155278531 |
| Molecular Formula | C43H84N4O6 |
| Molecular Weight | 753.17 g/mol |
| Exact Mass | 752.64 |
| IUPAC Name | octyl 8-[3-[[(Z)-1-(dimethylamino)-2-nitroethenyl]amino]propyl-(8-dodecan-6-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCC)CCCCCC)CCCN/C(=C/[N+](=O)[O-])N(C)C |
| InChI | InChI=1S/C43H84N4O6/c1-6-9-12-14-21-28-38-52-42(48)32-24-17-15-19-26-35-46(37-29-34-44-41(45(4)5)39-47(50)51)36-27-20-16-18-25-33-43(49)53-40(30-22-11-8-3)31-23-13-10-7-2/h39-40,44H,6-38H2,1-5H3/b41-39- |
| InChIKey | IOCPYOQMTVXKIJ-YTCTUYNNSA-N |
| XLogP | 10.95 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.17 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|