C46H93N3O3S — CID 142431602
heptadecan-9-yl 8-[3-(methylcarbamothioylamino)propyl-(8-octoxyoctyl)amino]octanoate (PubChem CID 142431602) has the molecular formula C46H93N3O3S and a molecular weight of 768.33 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-(methylcarbamothioylamino)propyl-(8-octoxyoctyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-(methylcarbamothioylamino)propyl-(8-octoxyoctyl)amino]octanoate |
|---|---|
| PubChem CID | 142431602 |
| Molecular Formula | C46H93N3O3S |
| Molecular Weight | 768.33 g/mol |
| Exact Mass | 767.69 |
| IUPAC Name | heptadecan-9-yl 8-[3-(methylcarbamothioylamino)propyl-(8-octoxyoctyl)amino]octanoate |
| SMILES | CCCCCCCCOCCCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNC(=S)NC |
| InChI | InChI=1S/C46H93N3O3S/c1-5-8-11-14-20-27-35-44(36-28-21-15-12-9-6-2)52-45(50)37-29-22-19-24-31-40-49(41-34-38-48-46(53)47-4)39-30-23-17-18-26-33-43-51-42-32-25-16-13-10-7-3/h44H,5-43H2,1-4H3,(H2,47,48,53) |
| InChIKey | APLFQKGQJJRCSB-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.33 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|