C44H89NO4 — CID 167036793
heptadecan-9-yl 8-[[(2R)-2-hydroxypropyl]-(7-nonoxyheptyl)amino]octanoate (PubChem CID 167036793) has the molecular formula C44H89NO4 and a molecular weight of 696.20 g/mol. Its IUPAC name is heptadecan-9-yl 8-[[(2R)-2-hydroxypropyl]-(7-nonoxyheptyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[[(2R)-2-hydroxypropyl]-(7-nonoxyheptyl)amino]octanoate |
|---|---|
| PubChem CID | 167036793 |
| Molecular Formula | C44H89NO4 |
| Molecular Weight | 696.20 g/mol |
| Exact Mass | 695.68 |
| IUPAC Name | heptadecan-9-yl 8-[[(2R)-2-hydroxypropyl]-(7-nonoxyheptyl)amino]octanoate |
| SMILES | CCCCCCCCCOCCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)C[C@@H](C)O |
| InChI | InChI=1S/C44H89NO4/c1-5-8-11-14-17-25-32-39-48-40-33-26-19-24-31-38-45(41-42(4)46)37-30-23-18-22-29-36-44(47)49-43(34-27-20-15-12-9-6-2)35-28-21-16-13-10-7-3/h42-43,46H,5-41H2,1-4H3/t42-/m1/s1 |
| InChIKey | FQIWXUPXKFHYTN-HUESYALOSA-N |
| XLogP | 13.14 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.20 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|