C49H99NO6 — CID 161476893
dodecan-4-yl 8-[2,3-dihydroxypropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate;methane (PubChem CID 161476893) has the molecular formula C49H99NO6 and a molecular weight of 798.33 g/mol. Its IUPAC name is dodecan-4-yl 8-[2,3-dihydroxypropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate;methane.
| Compound Name | dodecan-4-yl 8-[2,3-dihydroxypropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate;methane |
|---|---|
| PubChem CID | 161476893 |
| Molecular Formula | C49H99NO6 |
| Molecular Weight | 798.33 g/mol |
| Exact Mass | 797.75 |
| IUPAC Name | dodecan-4-yl 8-[2,3-dihydroxypropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate;methane |
| SMILES | C.CCCCCCCCC(CCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CC(O)CO |
| InChI | InChI=1S/C48H95NO6.CH4/c1-5-9-12-15-20-27-35-45(34-8-4)54-47(52)38-30-23-18-25-32-40-49(42-44(51)43-50)41-33-26-19-24-31-39-48(53)55-46(36-28-21-16-13-10-6-2)37-29-22-17-14-11-7-3;/h44-46,50-51H,5-43H2,1-4H3;1H4 |
| InChIKey | WDVIEQZDONAVFC-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.33 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|