C51H101N3O4 — CID 146180730
dodecan-4-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[1-(methylamino)ethenylamino]propyl]amino]octanoate (PubChem CID 146180730) has the molecular formula C51H101N3O4 and a molecular weight of 820.39 g/mol. Its IUPAC name is dodecan-4-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[1-(methylamino)ethenylamino]propyl]amino]octanoate.
| Compound Name | dodecan-4-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[1-(methylamino)ethenylamino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 146180730 |
| Molecular Formula | C51H101N3O4 |
| Molecular Weight | 820.39 g/mol |
| Exact Mass | 819.78 |
| IUPAC Name | dodecan-4-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[1-(methylamino)ethenylamino]propyl]amino]octanoate |
| SMILES | C=C(NC)NCCCN(CCCCCCCC(=O)OC(CCC)CCCCCCCC)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C51H101N3O4/c1-7-11-14-17-22-29-38-48(37-10-4)57-50(55)41-32-25-20-27-34-44-54(46-36-43-53-47(5)52-6)45-35-28-21-26-33-42-51(56)58-49(39-30-23-18-15-12-8-2)40-31-24-19-16-13-9-3/h48-49,52-53H,5,7-46H2,1-4,6H3 |
| InChIKey | HSRZIESDLOLDGZ-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.39 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|