C51H100N2O6 — CID 146447787
undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]octanoate (PubChem CID 146447787) has the molecular formula C51H100N2O6 and a molecular weight of 837.37 g/mol. Its IUPAC name is undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]octanoate.
| Compound Name | undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]octanoate |
|---|---|
| PubChem CID | 146447787 |
| Molecular Formula | C51H100N2O6 |
| Molecular Weight | 837.37 g/mol |
| Exact Mass | 836.76 |
| IUPAC Name | undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C51H100N2O6/c1-8-12-15-18-23-30-37-46(11-4)57-48(54)40-33-26-21-28-35-43-53(45-42-52-50(56)59-51(5,6)7)44-36-29-22-27-34-41-49(55)58-47(38-31-24-19-16-13-9-2)39-32-25-20-17-14-10-3/h46-47H,8-45H2,1-7H3,(H,52,56) |
| InChIKey | NIPLSQAKOSCPMZ-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.37 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|