C27H52N2O8 — CID 160704343
4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;nonan-3-yl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 160704343) has the molecular formula C27H52N2O8 and a molecular weight of 532.72 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;nonan-3-yl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;nonan-3-yl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 160704343 |
| Molecular Formula | C27H52N2O8 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;nonan-3-yl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)O.CCCCCCC(CC)OC(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO4.C9H17NO4/c1-6-8-9-10-12-15(7-2)22-16(20)13-11-14-19-17(21)23-18(3,4)5;1-9(2,3)14-8(13)10-6-4-5-7(11)12/h15H,6-14H2,1-5H3,(H,19,21);4-6H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | RRAJTDJKMNAMGK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|