C35H70N2O6 — CID 160818400
nonan-3-yl 6-aminohexanoate;nonan-3-yl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 160818400) has the molecular formula C35H70N2O6 and a molecular weight of 614.95 g/mol. Its IUPAC name is nonan-3-yl 6-aminohexanoate;nonan-3-yl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | nonan-3-yl 6-aminohexanoate;nonan-3-yl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 160818400 |
| Molecular Formula | C35H70N2O6 |
| Molecular Weight | 614.95 g/mol |
| Exact Mass | 614.52 |
| IUPAC Name | nonan-3-yl 6-aminohexanoate;nonan-3-yl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CCCCCCC(CC)OC(=O)CCCCCN.CCCCCCC(CC)OC(=O)CCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39NO4.C15H31NO2/c1-6-8-9-11-14-17(7-2)24-18(22)15-12-10-13-16-21-19(23)25-20(3,4)5;1-3-5-6-8-11-14(4-2)18-15(17)12-9-7-10-13-16/h17H,6-16H2,1-5H3,(H,21,23);14H,3-13,16H2,1-2H3 |
| InChIKey | SFFFXPVWZCYUDI-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.95 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|