C25H49NO4 — CID 134607308
hexadecan-8-yl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 134607308) has the molecular formula C25H49NO4 and a molecular weight of 427.67 g/mol. Its IUPAC name is hexadecan-8-yl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | hexadecan-8-yl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 134607308 |
| Molecular Formula | C25H49NO4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.37 |
| IUPAC Name | hexadecan-8-yl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCCCCCCCC(CCCCCCC)OC(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H49NO4/c1-6-8-10-12-14-16-19-22(18-15-13-11-9-7-2)29-23(27)20-17-21-26-24(28)30-25(3,4)5/h22H,6-21H2,1-5H3,(H,26,28) |
| InChIKey | GFABKWJWFUEWQA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|