C34H68N2O4 — CID 164551917
heptadecan-9-yl 8-[[2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]octanoate (PubChem CID 164551917) has the molecular formula C34H68N2O4 and a molecular weight of 568.93 g/mol. Its IUPAC name is heptadecan-9-yl 8-[[2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[[2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 164551917 |
| Molecular Formula | C34H68N2O4 |
| Molecular Weight | 568.93 g/mol |
| Exact Mass | 568.52 |
| IUPAC Name | heptadecan-9-yl 8-[[2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCNCC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H68N2O4/c1-7-9-11-13-16-20-24-31(25-21-17-14-12-10-8-2)39-32(37)26-22-18-15-19-23-27-35-28-30(3)29-36-33(38)40-34(4,5)6/h30-31,35H,7-29H2,1-6H3,(H,36,38) |
| InChIKey | BGIYVSCQDKMDFI-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.93 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|