C39H77N3O6 — CID 139581667
heptadecan-9-yl 8-[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]ethylamino]octanoate (PubChem CID 139581667) has the molecular formula C39H77N3O6 and a molecular weight of 684.06 g/mol. Its IUPAC name is heptadecan-9-yl 8-[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]ethylamino]octanoate.
| Compound Name | heptadecan-9-yl 8-[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]ethylamino]octanoate |
|---|---|
| PubChem CID | 139581667 |
| Molecular Formula | C39H77N3O6 |
| Molecular Weight | 684.06 g/mol |
| Exact Mass | 683.58 |
| IUPAC Name | heptadecan-9-yl 8-[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]ethylamino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCNCCN(CCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H77N3O6/c1-9-11-13-15-18-22-26-34(27-23-19-16-14-12-10-2)46-35(43)28-24-20-17-21-25-29-40-30-32-42(37(45)48-39(6,7)8)33-31-41-36(44)47-38(3,4)5/h34,40H,9-33H2,1-8H3,(H,41,44) |
| InChIKey | YIEUDLSWCHCRQB-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.06 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|