C52H100N2O8 — CID 171795837
dipentyl 2-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]hexyl]propanedioate (PubChem CID 171795837) has the molecular formula C52H100N2O8 and a molecular weight of 881.38 g/mol. Its IUPAC name is dipentyl 2-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]hexyl]propanedioate.
| Compound Name | dipentyl 2-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]hexyl]propanedioate |
|---|---|
| PubChem CID | 171795837 |
| Molecular Formula | C52H100N2O8 |
| Molecular Weight | 881.38 g/mol |
| Exact Mass | 880.75 |
| IUPAC Name | dipentyl 2-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]hexyl]propanedioate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCC(C(=O)OCCCCC)C(=O)OCCCCC)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C52H100N2O8/c1-8-12-16-18-21-27-36-46(37-28-22-19-17-13-9-2)61-48(55)39-30-23-20-25-31-41-54(43-35-40-53-51(58)62-52(5,6)7)42-32-26-24-29-38-47(49(56)59-44-33-14-10-3)50(57)60-45-34-15-11-4/h46-47H,8-45H2,1-7H3,(H,53,58) |
| InChIKey | YMFAZHZOKVXRPU-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.38 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|