C52H95N3O8 — CID 171795852
dipentyl 2-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]hexyl]propanedioate (PubChem CID 171795852) has the molecular formula C52H95N3O8 and a molecular weight of 890.34 g/mol. Its IUPAC name is dipentyl 2-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]hexyl]propanedioate.
| Compound Name | dipentyl 2-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]hexyl]propanedioate |
|---|---|
| PubChem CID | 171795852 |
| Molecular Formula | C52H95N3O8 |
| Molecular Weight | 890.34 g/mol |
| Exact Mass | 889.71 |
| IUPAC Name | dipentyl 2-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]hexyl]propanedioate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCC(C(=O)OCCCCC)C(=O)OCCCCC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C52H95N3O8/c1-6-10-14-16-19-25-34-44(35-26-20-17-15-11-7-2)63-46(56)37-28-21-18-23-29-39-55(41-33-38-54-48-47(53-5)49(57)50(48)58)40-30-24-22-27-36-45(51(59)61-42-31-12-8-3)52(60)62-43-32-13-9-4/h44-45,53-54H,6-43H2,1-5H3 |
| InChIKey | CTVIJKCEPFYMFY-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.34 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|