C35H65N3O4 — CID 129232925
heptadecan-9-yl 8-[ethyl-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate (PubChem CID 129232925) has the molecular formula C35H65N3O4 and a molecular weight of 591.92 g/mol. Its IUPAC name is heptadecan-9-yl 8-[ethyl-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[ethyl-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 129232925 |
| Molecular Formula | C35H65N3O4 |
| Molecular Weight | 591.92 g/mol |
| Exact Mass | 591.50 |
| IUPAC Name | heptadecan-9-yl 8-[ethyl-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C35H65N3O4/c1-5-8-10-12-15-19-24-30(25-20-16-13-11-9-6-2)42-31(39)26-21-17-14-18-22-28-38(7-3)29-23-27-37-33-32(36-4)34(40)35(33)41/h30,36-37H,5-29H2,1-4H3 |
| InChIKey | SLQPJSCFZAXKMR-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.92 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|