C40H73N3O6 — CID 174317242
8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[2-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]ethyl]amino]octanoic acid (PubChem CID 174317242) has the molecular formula C40H73N3O6 and a molecular weight of 692.04 g/mol. Its IUPAC name is 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[2-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]ethyl]amino]octanoic acid.
| Compound Name | 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[2-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]ethyl]amino]octanoic acid |
|---|---|
| PubChem CID | 174317242 |
| Molecular Formula | C40H73N3O6 |
| Molecular Weight | 692.04 g/mol |
| Exact Mass | 691.55 |
| IUPAC Name | 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[2-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]ethyl]amino]octanoic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)O)CCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C40H73N3O6/c1-4-6-8-10-14-20-26-34(27-21-15-11-9-7-5-2)49-36(46)29-23-17-13-19-25-32-43(31-24-18-12-16-22-28-35(44)45)33-30-42-38-37(41-3)39(47)40(38)48/h34,41-42H,4-33H2,1-3H3,(H,44,45) |
| InChIKey | HYLRGLRZBZVOKD-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.04 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|