C52H98N4O6 — CID 167389145
nonyl 8-[3-[[2-[2-(dimethylamino)ethylamino]-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 167389145) has the molecular formula C52H98N4O6 and a molecular weight of 875.38 g/mol. Its IUPAC name is nonyl 8-[3-[[2-[2-(dimethylamino)ethylamino]-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[3-[[2-[2-(dimethylamino)ethylamino]-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 167389145 |
| Molecular Formula | C52H98N4O6 |
| Molecular Weight | 875.38 g/mol |
| Exact Mass | 874.75 |
| IUPAC Name | nonyl 8-[3-[[2-[2-(dimethylamino)ethylamino]-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCC)CCCCCCCC)CCCNc1c(NCCN(C)C)c(=O)c1=O |
| InChI | InChI=1S/C52H98N4O6/c1-6-9-12-15-17-26-33-45-61-47(57)37-29-22-18-24-31-41-56(43-34-39-53-49-50(52(60)51(49)59)54-40-44-55(4)5)42-32-25-19-23-30-38-48(58)62-46(35-27-20-14-11-8-3)36-28-21-16-13-10-7-2/h46,53-54H,6-45H2,1-5H3 |
| InChIKey | KBKLHKXYKWKGCT-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.38 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|