C50H93N3O6 — CID 135329693
7-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]heptyl decanoate (PubChem CID 135329693) has the molecular formula C50H93N3O6 and a molecular weight of 832.31 g/mol. Its IUPAC name is 7-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]heptyl decanoate.
| Compound Name | 7-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]heptyl decanoate |
|---|---|
| PubChem CID | 135329693 |
| Molecular Formula | C50H93N3O6 |
| Molecular Weight | 832.31 g/mol |
| Exact Mass | 831.71 |
| IUPAC Name | 7-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]heptyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C50H93N3O6/c1-5-8-11-14-17-22-29-37-45(54)58-43-33-26-19-25-32-41-53(42-34-39-52-48-47(51-4)49(56)50(48)57)40-31-24-18-23-30-38-46(55)59-44(35-27-20-15-12-9-6-2)36-28-21-16-13-10-7-3/h44,51-52H,5-43H2,1-4H3 |
| InChIKey | WCPRSECDJOBBDQ-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.31 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|