C54H101N3O10 — CID 163381115
1,3-dihexoxypropan-2-yl 8-[[8-(1,3-dihexoxypropan-2-yloxy)-8-oxooctyl]-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate (PubChem CID 163381115) has the molecular formula C54H101N3O10 and a molecular weight of 952.41 g/mol. Its IUPAC name is 1,3-dihexoxypropan-2-yl 8-[[8-(1,3-dihexoxypropan-2-yloxy)-8-oxooctyl]-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate.
| Compound Name | 1,3-dihexoxypropan-2-yl 8-[[8-(1,3-dihexoxypropan-2-yloxy)-8-oxooctyl]-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 163381115 |
| Molecular Formula | C54H101N3O10 |
| Molecular Weight | 952.41 g/mol |
| Exact Mass | 951.75 |
| IUPAC Name | 1,3-dihexoxypropan-2-yl 8-[[8-(1,3-dihexoxypropan-2-yloxy)-8-oxooctyl]-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
| SMILES | CCCCCCOCC(COCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(COCCCCCC)COCCCCCC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C54H101N3O10/c1-6-10-14-28-39-62-43-47(44-63-40-29-15-11-7-2)66-49(58)33-24-20-18-22-26-36-57(38-32-35-56-52-51(55-5)53(60)54(52)61)37-27-23-19-21-25-34-50(59)67-48(45-64-41-30-16-12-8-3)46-65-42-31-17-13-9-4/h47-48,55-56H,6-46H2,1-5H3 |
| InChIKey | DKXSQGUCXIIAEO-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.41 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|