C40H73N3O7 — CID 170755089
heptadecan-9-yl 8-[6-carboxyoxyhexyl-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate (PubChem CID 170755089) has the molecular formula C40H73N3O7 and a molecular weight of 708.04 g/mol. Its IUPAC name is heptadecan-9-yl 8-[6-carboxyoxyhexyl-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[6-carboxyoxyhexyl-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 170755089 |
| Molecular Formula | C40H73N3O7 |
| Molecular Weight | 708.04 g/mol |
| Exact Mass | 707.54 |
| IUPAC Name | heptadecan-9-yl 8-[6-carboxyoxyhexyl-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCOC(=O)O)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C40H73N3O7/c1-4-6-8-10-13-19-26-34(27-20-14-11-9-7-5-2)50-35(44)28-21-15-12-16-22-30-43(31-23-17-18-24-33-49-40(47)48)32-25-29-42-37-36(41-3)38(45)39(37)46/h34,41-42H,4-33H2,1-3H3,(H,47,48) |
| InChIKey | WQVAQFQRKFXVQC-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.04 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|