C51H95N3O6 — CID 139376725
nonyl 8-[3-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 139376725) has the molecular formula C51H95N3O6 and a molecular weight of 846.34 g/mol. Its IUPAC name is nonyl 8-[3-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[3-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 139376725 |
| Molecular Formula | C51H95N3O6 |
| Molecular Weight | 846.34 g/mol |
| Exact Mass | 845.72 |
| IUPAC Name | nonyl 8-[3-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNc1c(NCC)c(=O)c1=O |
| InChI | InChI=1S/C51H95N3O6/c1-5-9-12-15-18-27-34-44-59-46(55)38-30-23-19-25-32-41-54(43-35-40-53-49-48(52-8-4)50(57)51(49)58)42-33-26-20-24-31-39-47(56)60-45(36-28-21-16-13-10-6-2)37-29-22-17-14-11-7-3/h45,52-53H,5-44H2,1-4H3 |
| InChIKey | XACOQQCUWSNLOJ-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.34 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|