C33H61N3O4 — CID 134463551
nonyl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-octylamino]octanoate (PubChem CID 134463551) has the molecular formula C33H61N3O4 and a molecular weight of 563.87 g/mol. Its IUPAC name is nonyl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-octylamino]octanoate.
| Compound Name | nonyl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-octylamino]octanoate |
|---|---|
| PubChem CID | 134463551 |
| Molecular Formula | C33H61N3O4 |
| Molecular Weight | 563.87 g/mol |
| Exact Mass | 563.47 |
| IUPAC Name | nonyl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-octylamino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C33H61N3O4/c1-4-6-8-10-12-17-21-28-40-29(37)23-18-14-13-16-20-26-36(25-19-15-11-9-7-5-2)27-22-24-35-31-30(34-3)32(38)33(31)39/h34-35H,4-28H2,1-3H3 |
| InChIKey | MWGOHRWESNZJKB-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.87 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|