C25H47N3O2 — CID 176664991
3-[4-(dioctylamino)butylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione (PubChem CID 176664991) has the molecular formula C25H47N3O2 and a molecular weight of 421.67 g/mol. Its IUPAC name is 3-[4-(dioctylamino)butylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-(dioctylamino)butylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 176664991 |
| Molecular Formula | C25H47N3O2 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.37 |
| IUPAC Name | 3-[4-(dioctylamino)butylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C25H47N3O2/c1-4-6-8-10-12-15-19-28(20-16-13-11-9-7-5-2)21-17-14-18-27-23-22(26-3)24(29)25(23)30/h26-27H,4-21H2,1-3H3 |
| InChIKey | LTYWELKDONYINU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|