C48H93N3O6 — CID 170756914
formic acid;3-[3-[8-heptylpentadecyl(10-propyltridecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione (PubChem CID 170756914) has the molecular formula C48H93N3O6 and a molecular weight of 808.29 g/mol. Its IUPAC name is formic acid;3-[3-[8-heptylpentadecyl(10-propyltridecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | formic acid;3-[3-[8-heptylpentadecyl(10-propyltridecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 170756914 |
| Molecular Formula | C48H93N3O6 |
| Molecular Weight | 808.29 g/mol |
| Exact Mass | 807.71 |
| IUPAC Name | formic acid;3-[3-[8-heptylpentadecyl(10-propyltridecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCCCCCCC(CCCCCCC)CCCCCCCN(CCCCCCCCCC(CCC)CCC)CCCNc1c(NC)c(=O)c1=O.O=CO.O=CO |
| InChI | InChI=1S/C46H89N3O2.2CH2O2/c1-6-10-12-18-24-34-42(35-25-19-13-11-7-2)36-27-21-17-23-29-39-49(40-30-37-48-44-43(47-5)45(50)46(44)51)38-28-22-16-14-15-20-26-33-41(31-8-3)32-9-4;2*2-1-3/h41-42,47-48H,6-40H2,1-5H3;2*1H,(H,2,3) |
| InChIKey | ZWVIINBRJUWPOK-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.29 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|