C51H99N3O6 — CID 170754956
3-[2-(dimethylamino)ethylamino]-4-[8-octylhexadecyl(8-propyltetradecyl)amino]cyclobut-3-ene-1,2-dione;formic acid (PubChem CID 170754956) has the molecular formula C51H99N3O6 and a molecular weight of 850.37 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylamino]-4-[8-octylhexadecyl(8-propyltetradecyl)amino]cyclobut-3-ene-1,2-dione;formic acid.
| Compound Name | 3-[2-(dimethylamino)ethylamino]-4-[8-octylhexadecyl(8-propyltetradecyl)amino]cyclobut-3-ene-1,2-dione;formic acid |
|---|---|
| PubChem CID | 170754956 |
| Molecular Formula | C51H99N3O6 |
| Molecular Weight | 850.37 g/mol |
| Exact Mass | 849.75 |
| IUPAC Name | 3-[2-(dimethylamino)ethylamino]-4-[8-octylhexadecyl(8-propyltetradecyl)amino]cyclobut-3-ene-1,2-dione;formic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)CCCCCCCN(CCCCCCCC(CCC)CCCCCC)c1c(NCCN(C)C)c(=O)c1=O.O=CO.O=CO |
| InChI | InChI=1S/C49H95N3O2.2CH2O2/c1-7-11-14-17-21-29-37-45(38-30-22-18-15-12-8-2)39-31-24-20-26-33-42-52(47-46(48(53)49(47)54)50-40-43-51(5)6)41-32-25-19-23-28-36-44(34-10-4)35-27-16-13-9-3;2*2-1-3/h44-45,50H,7-43H2,1-6H3;2*1H,(H,2,3) |
| InChIKey | BBDYCNUWVXZEDY-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.37 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|