C52H101N3O6 — CID 171538936
decan-4-yl formate;3-[2-(dimethylamino)ethylamino]-4-[octyl(8-octylhexadecyl)amino]cyclobut-3-ene-1,2-dione;formic acid (PubChem CID 171538936) has the molecular formula C52H101N3O6 and a molecular weight of 864.39 g/mol. Its IUPAC name is decan-4-yl formate;3-[2-(dimethylamino)ethylamino]-4-[octyl(8-octylhexadecyl)amino]cyclobut-3-ene-1,2-dione;formic acid.
| Compound Name | decan-4-yl formate;3-[2-(dimethylamino)ethylamino]-4-[octyl(8-octylhexadecyl)amino]cyclobut-3-ene-1,2-dione;formic acid |
|---|---|
| PubChem CID | 171538936 |
| Molecular Formula | C52H101N3O6 |
| Molecular Weight | 864.39 g/mol |
| Exact Mass | 863.77 |
| IUPAC Name | decan-4-yl formate;3-[2-(dimethylamino)ethylamino]-4-[octyl(8-octylhexadecyl)amino]cyclobut-3-ene-1,2-dione;formic acid |
| SMILES | CCCCCCC(CCC)OC=O.CCCCCCCCC(CCCCCCCC)CCCCCCCN(CCCCCCCC)c1c(NCCN(C)C)c(=O)c1=O.O=CO |
| InChI | InChI=1S/C40H77N3O2.C11H22O2.CH2O2/c1-6-9-12-15-19-24-29-36(30-25-20-16-13-10-7-2)31-26-21-18-23-28-34-43(33-27-22-17-14-11-8-3)38-37(39(44)40(38)45)41-32-35-42(4)5;1-3-5-6-7-9-11(8-4-2)13-10-12;2-1-3/h36,41H,6-35H2,1-5H3;10-11H,3-9H2,1-2H3;1H,(H,2,3) |
| InChIKey | SSDMZVAHYNPYHY-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.39 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|