C46H89N3O2 — CID 170756915
3-[3-[8-heptylpentadecyl(10-propyltridecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione (PubChem CID 170756915) has the molecular formula C46H89N3O2 and a molecular weight of 716.24 g/mol. Its IUPAC name is 3-[3-[8-heptylpentadecyl(10-propyltridecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-[8-heptylpentadecyl(10-propyltridecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 170756915 |
| Molecular Formula | C46H89N3O2 |
| Molecular Weight | 716.24 g/mol |
| Exact Mass | 715.70 |
| IUPAC Name | 3-[3-[8-heptylpentadecyl(10-propyltridecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCCCCCCC(CCCCCCC)CCCCCCCN(CCCCCCCCCC(CCC)CCC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C46H89N3O2/c1-6-10-12-18-24-34-42(35-25-19-13-11-7-2)36-27-21-17-23-29-39-49(40-30-37-48-44-43(47-5)45(50)46(44)51)38-28-22-16-14-15-20-26-33-41(31-8-3)32-9-4/h41-42,47-48H,6-40H2,1-5H3 |
| InChIKey | WYSBVOZBWZQTFE-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.24 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|